C8H16N2O4 — CID 66177308
3-acetamido-N-(2,3-dihydroxypropyl)propanamide (PubChem CID 66177308) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-acetamido-N-(2,3-dihydroxypropyl)propanamide.
| Compound Name | 3-acetamido-N-(2,3-dihydroxypropyl)propanamide |
|---|---|
| PubChem CID | 66177308 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3-acetamido-N-(2,3-dihydroxypropyl)propanamide |
| SMILES | CC(=O)NCCC(=O)NCC(O)CO |
| InChI | InChI=1S/C8H16N2O4/c1-6(12)9-3-2-8(14)10-4-7(13)5-11/h7,11,13H,2-5H2,1H3,(H,9,12)(H,10,14) |
| InChIKey | QERFGDFCSGFDOJ-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |