C10H18BrNO3 — CID 103492399
methyl 2-bromo-3-(3,3-dimethylbutanoylamino)propanoate (PubChem CID 103492399) has the molecular formula C10H18BrNO3 and a molecular weight of 280.16 g/mol. Its IUPAC name is methyl 2-bromo-3-(3,3-dimethylbutanoylamino)propanoate.
| Compound Name | methyl 2-bromo-3-(3,3-dimethylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 103492399 |
| Molecular Formula | C10H18BrNO3 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | methyl 2-bromo-3-(3,3-dimethylbutanoylamino)propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H18BrNO3/c1-10(2,3)5-8(13)12-6-7(11)9(14)15-4/h7H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | BWPNBVWECPYDEB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|