C9H18N2O4 — CID 107222707
methyl 3-[(3-amino-3-methylbutanoyl)amino]-2-hydroxypropanoate (PubChem CID 107222707) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 3-[(3-amino-3-methylbutanoyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-amino-3-methylbutanoyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107222707 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | methyl 3-[(3-amino-3-methylbutanoyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)CC(C)(C)N |
| InChI | InChI=1S/C9H18N2O4/c1-9(2,10)4-7(13)11-5-6(12)8(14)15-3/h6,12H,4-5,10H2,1-3H3,(H,11,13) |
| InChIKey | DXGRVXLFGZBHCA-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |