C10H17NO6 — CID 107214923
6-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-6-oxohexanoic acid (PubChem CID 107214923) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-6-oxohexanoic acid.
| Compound Name | 6-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 107214923 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-6-oxohexanoic acid |
| SMILES | COC(=O)C(O)CNC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C10H17NO6/c1-17-10(16)7(12)6-11-8(13)4-2-3-5-9(14)15/h7,12H,2-6H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | FTWFTUKNVNGWJW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|