C15H21NO5 — CID 103957800
methyl 2-hydroxy-3-[4-(4-methylphenoxy)butanoylamino]propanoate (PubChem CID 103957800) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[4-(4-methylphenoxy)butanoylamino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[4-(4-methylphenoxy)butanoylamino]propanoate |
|---|---|
| PubChem CID | 103957800 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 2-hydroxy-3-[4-(4-methylphenoxy)butanoylamino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C15H21NO5/c1-11-5-7-12(8-6-11)21-9-3-4-14(18)16-10-13(17)15(19)20-2/h5-8,13,17H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | ZTLKSDIGLOMPDX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|