C13H18N2O5 — CID 107211638
methyl 3-[3-(4-aminophenoxy)propanoylamino]-2-hydroxypropanoate (PubChem CID 107211638) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 3-[3-(4-aminophenoxy)propanoylamino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[3-(4-aminophenoxy)propanoylamino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107211638 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 3-[3-(4-aminophenoxy)propanoylamino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)CCOc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N2O5/c1-19-13(18)11(16)8-15-12(17)6-7-20-10-4-2-9(14)3-5-10/h2-5,11,16H,6-8,14H2,1H3,(H,15,17) |
| InChIKey | WMWYHDKCMWEKDA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|