C14H19NO6 — CID 103957989
methyl 2-hydroxy-3-[3-(4-methoxyphenoxy)propanoylamino]propanoate (PubChem CID 103957989) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[3-(4-methoxyphenoxy)propanoylamino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[3-(4-methoxyphenoxy)propanoylamino]propanoate |
|---|---|
| PubChem CID | 103957989 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 2-hydroxy-3-[3-(4-methoxyphenoxy)propanoylamino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)CCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19NO6/c1-19-10-3-5-11(6-4-10)21-8-7-13(17)15-9-12(16)14(18)20-2/h3-6,12,16H,7-9H2,1-2H3,(H,15,17) |
| InChIKey | HYJYDWJCSVNDIR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |