C15H24N2O2 — CID 103459992
3-(4-aminophenoxy)-N-(2,2-dimethylbutyl)propanamide (PubChem CID 103459992) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(4-aminophenoxy)-N-(2,2-dimethylbutyl)propanamide.
| Compound Name | 3-(4-aminophenoxy)-N-(2,2-dimethylbutyl)propanamide |
|---|---|
| PubChem CID | 103459992 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-(4-aminophenoxy)-N-(2,2-dimethylbutyl)propanamide |
| SMILES | CCC(C)(C)CNC(=O)CCOc1ccc(N)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-4-15(2,3)11-17-14(18)9-10-19-13-7-5-12(16)6-8-13/h5-8H,4,9-11,16H2,1-3H3,(H,17,18) |
| InChIKey | SNFSNPFTZXUZBS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|