C9H16BrNO4 — CID 75525942
methyl 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 75525942) has the molecular formula C9H16BrNO4 and a molecular weight of 282.13 g/mol. Its IUPAC name is methyl 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 75525942 |
| Molecular Formula | C9H16BrNO4 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | methyl 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H16BrNO4/c1-9(2,3)15-8(13)11-5-6(10)7(12)14-4/h6H,5H2,1-4H3,(H,11,13) |
| InChIKey | RFCMKEZZBUQPDF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|