C8H18N2O3 — CID 65440271
(2S)-2-amino-N-(2,3-dihydroxypropyl)-3-methylbutanamide (PubChem CID 65440271) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,3-dihydroxypropyl)-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-(2,3-dihydroxypropyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 65440271 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (2S)-2-amino-N-(2,3-dihydroxypropyl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(O)CO |
| InChI | InChI=1S/C8H18N2O3/c1-5(2)7(9)8(13)10-3-6(12)4-11/h5-7,11-12H,3-4,9H2,1-2H3,(H,10,13)/t6?,7-/m0/s1 |
| InChIKey | WYKHGMFDDZKSGF-MLWJPKLSSA-N |
| XLogP | -1.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |