C7H15NO4 — CID 90334941
N-(2,3-dihydroxypropyl)-2-hydroxybutanamide (PubChem CID 90334941) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-hydroxybutanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-hydroxybutanamide |
|---|---|
| PubChem CID | 90334941 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-hydroxybutanamide |
| SMILES | CCC(O)C(=O)NCC(O)CO |
| InChI | InChI=1S/C7H15NO4/c1-2-6(11)7(12)8-3-5(10)4-9/h5-6,9-11H,2-4H2,1H3,(H,8,12) |
| InChIKey | SYIANCATUZNSNS-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |