C8H15NO4 — CID 134194631
N-[(2R)-2,3-dihydroxypropyl]-3-methyl-2-oxobutanamide (PubChem CID 134194631) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[(2R)-2,3-dihydroxypropyl]-3-methyl-2-oxobutanamide.
| Compound Name | N-[(2R)-2,3-dihydroxypropyl]-3-methyl-2-oxobutanamide |
|---|---|
| PubChem CID | 134194631 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(2R)-2,3-dihydroxypropyl]-3-methyl-2-oxobutanamide |
| SMILES | CC(C)C(=O)C(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C8H15NO4/c1-5(2)7(12)8(13)9-3-6(11)4-10/h5-6,10-11H,3-4H2,1-2H3,(H,9,13)/t6-/m1/s1 |
| InChIKey | IGOKHJBKIRUIRR-ZCFIWIBFSA-N |
| XLogP | -1.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|