C6H16NO7P — CID 87238099
2-hydroxy-N-(2-hydroxyethyl)butanamide;phosphoric acid (PubChem CID 87238099) has the molecular formula C6H16NO7P and a molecular weight of 245.17 g/mol. Its IUPAC name is 2-hydroxy-N-(2-hydroxyethyl)butanamide;phosphoric acid.
| Compound Name | 2-hydroxy-N-(2-hydroxyethyl)butanamide;phosphoric acid |
|---|---|
| PubChem CID | 87238099 |
| Molecular Formula | C6H16NO7P |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-hydroxy-N-(2-hydroxyethyl)butanamide;phosphoric acid |
| SMILES | CCC(O)C(=O)NCCO.O=P(O)(O)O |
| InChI | InChI=1S/C6H13NO3.H3O4P/c1-2-5(9)6(10)7-3-4-8;1-5(2,3)4/h5,8-9H,2-4H2,1H3,(H,7,10);(H3,1,2,3,4) |
| InChIKey | ZNZZSHYEYHOXDP-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|