N-(2-hydroxyethyl)hexadecanamide;phosphoric acid

C18H40NO6P — CID 172708754

IUPACN-(2-hydroxyethyl)hexadecanamide;phosphoric acid
SMILESCCCCCCCCCCCCCCCC(=O)NCCO.O=P(O)(O)O
InChIInChI=1S/C18H37NO2.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20;1-5(2,3)4/h20H,2-17H2,1H3,(H,19,21);(H3,1,2,3,4)
InChIKeyDYMJKRUQRNYYQP-UHFFFAOYSA-N
MW397.49 g/mol
LogP3.65
Rot. Bonds16

About N-(2-hydroxyethyl)hexadecanamide;phosphoric acid

N-(2-hydroxyethyl)hexadecanamide;phosphoric acid (PubChem CID 172708754) has the molecular formula C18H40NO6P and a molecular weight of 397.49 g/mol. Its IUPAC name is N-(2-hydroxyethyl)hexadecanamide;phosphoric acid.

Molecular Properties

Compound NameN-(2-hydroxyethyl)hexadecanamide;phosphoric acid
PubChem CID172708754
Molecular FormulaC18H40NO6P
Molecular Weight397.49 g/mol
Exact Mass397.26
IUPAC NameN-(2-hydroxyethyl)hexadecanamide;phosphoric acid
SMILESCCCCCCCCCCCCCCCC(=O)NCCO.O=P(O)(O)O
InChIInChI=1S/C18H37NO2.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20;1-5(2,3)4/h20H,2-17H2,1H3,(H,19,21);(H3,1,2,3,4)
InChIKeyDYMJKRUQRNYYQP-UHFFFAOYSA-N
XLogP3.65
TPSA127.09 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds16
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500397.49
LogP ≤ 53.65
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N-(2-hydroxyethyl)hexadecanamide;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-hydroxyethyl)hexadecanamide;phosphoric acid?
The IUPAC name of N-(2-hydroxyethyl)hexadecanamide;phosphoric acid (CID 172708754) is N-(2-hydroxyethyl)hexadecanamide;phosphoric acid.
What is the SMILES notation for N-(2-hydroxyethyl)hexadecanamide;phosphoric acid?
The canonical SMILES for N-(2-hydroxyethyl)hexadecanamide;phosphoric acid is CCCCCCCCCCCCCCCC(=O)NCCO.O=P(O)(O)O.
What is the InChIKey of N-(2-hydroxyethyl)hexadecanamide;phosphoric acid?
The InChIKey is DYMJKRUQRNYYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20;1-5(2,3)4/h20H,2-17H2,1H3,(H,19,21);(H3,1,2,3,4).
What are the key properties of N-(2-hydroxyethyl)hexadecanamide;phosphoric acid?
N-(2-hydroxyethyl)hexadecanamide;phosphoric acid has a molecular weight of 397.49 g/mol, XLogP of 3.65, 16 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)hexadecanamide;phosphoric acid is sourced from PubChem (CID 172708754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).