C19H43N2O5P — CID 71587478
N-[3-(dimethylamino)propyl]tetradecanamide;phosphoric acid (PubChem CID 71587478) has the molecular formula C19H43N2O5P and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]tetradecanamide;phosphoric acid.
| Compound Name | N-[3-(dimethylamino)propyl]tetradecanamide;phosphoric acid |
|---|---|
| PubChem CID | 71587478 |
| Molecular Formula | C19H43N2O5P |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | N-[3-(dimethylamino)propyl]tetradecanamide;phosphoric acid |
| SMILES | CCCCCCCCCCCCCC(=O)NCCCN(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C19H40N2O.H3O4P/c1-4-5-6-7-8-9-10-11-12-13-14-16-19(22)20-17-15-18-21(2)3;1-5(2,3)4/h4-18H2,1-3H3,(H,20,22);(H3,1,2,3,4) |
| InChIKey | WDSHHJLKKKNVDS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|