C23H49N3O4 — CID 71346654
N-[3-(dimethylamino)propyl]octadecanamide;nitric acid (PubChem CID 71346654) has the molecular formula C23H49N3O4 and a molecular weight of 431.66 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]octadecanamide;nitric acid.
| Compound Name | N-[3-(dimethylamino)propyl]octadecanamide;nitric acid |
|---|---|
| PubChem CID | 71346654 |
| Molecular Formula | C23H49N3O4 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.37 |
| IUPAC Name | N-[3-(dimethylamino)propyl]octadecanamide;nitric acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)NCCCN(C)C.O=[N+]([O-])O |
| InChI | InChI=1S/C23H48N2O.HNO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3;2-1(3)4/h4-22H2,1-3H3,(H,24,26);(H,2,3,4) |
| InChIKey | ILIWERAOUIKELH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|