About CID 140756261
CID 140756261 (PubChem CID 140756261) has the molecular formula C23H47N2O
and a molecular weight of 367.64 g/mol.
Molecular Properties
| Compound Name | CID 140756261 |
| PubChem CID | 140756261 |
| Molecular Formula | C23H47N2O |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 367.37 |
| IUPAC Name | — |
| SMILES | [CH2]N(C)CCCNC(=O)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C23H47N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h2,4-22H2,1,3H3,(H,24,26) |
| InChIKey | ZABHABSALIMTGR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 140756261 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140756261?
The IUPAC name of CID 140756261 (CID 140756261) is not available.
What is the SMILES notation for CID 140756261?
The canonical SMILES for CID 140756261 is [CH2]N(C)CCCNC(=O)CCCCCCCCCCCCCCCCC.
What is the InChIKey of CID 140756261?
The InChIKey is ZABHABSALIMTGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H47N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h2,4-22H2,1,3H3,(H,24,26).
What are the key properties of CID 140756261?
CID 140756261 has a molecular weight of 367.64 g/mol, XLogP of 6.48, 20 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140756261 is sourced from PubChem (CID 140756261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).