About ethane;N-propylheptanamide
ethane;N-propylheptanamide (PubChem CID 145289188) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is ethane;N-propylheptanamide.
Molecular Properties
| Compound Name | ethane;N-propylheptanamide |
| PubChem CID | 145289188 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | ethane;N-propylheptanamide |
| SMILES | CC.CCCCCCC(=O)NCCC |
| InChI | InChI=1S/C10H21NO.C2H6/c1-3-5-6-7-8-10(12)11-9-4-2;1-2/h3-9H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | KJOUBNIULMFJFQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-propylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-propylheptanamide?
The IUPAC name of ethane;N-propylheptanamide (CID 145289188) is ethane;N-propylheptanamide.
What is the SMILES notation for ethane;N-propylheptanamide?
The canonical SMILES for ethane;N-propylheptanamide is CC.CCCCCCC(=O)NCCC.
What is the InChIKey of ethane;N-propylheptanamide?
The InChIKey is KJOUBNIULMFJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C2H6/c1-3-5-6-7-8-10(12)11-9-4-2;1-2/h3-9H2,1-2H3,(H,11,12);1-2H3.
What are the key properties of ethane;N-propylheptanamide?
ethane;N-propylheptanamide has a molecular weight of 201.35 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-propylheptanamide is sourced from PubChem (CID 145289188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).