C16H32N2O2 — CID 102239298
N,N'-dipropyldecanediamide (PubChem CID 102239298) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N,N'-dipropyldecanediamide.
| Compound Name | N,N'-dipropyldecanediamide |
|---|---|
| PubChem CID | 102239298 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N,N'-dipropyldecanediamide |
| SMILES | CCCNC(=O)CCCCCCCCC(=O)NCCC |
| InChI | InChI=1S/C16H32N2O2/c1-3-13-17-15(19)11-9-7-5-6-8-10-12-16(20)18-14-4-2/h3-14H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | RECFLYNDPQVJMK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|