About 8-oxo-N-propyldecanamide
8-oxo-N-propyldecanamide (PubChem CID 156819961) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 8-oxo-N-propyldecanamide.
Molecular Properties
| Compound Name | 8-oxo-N-propyldecanamide |
| PubChem CID | 156819961 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 8-oxo-N-propyldecanamide |
| SMILES | CCCNC(=O)CCCCCCC(=O)CC |
| InChI | InChI=1S/C13H25NO2/c1-3-11-14-13(16)10-8-6-5-7-9-12(15)4-2/h3-11H2,1-2H3,(H,14,16) |
| InChIKey | JCNNMKBXJNVAGJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-oxo-N-propyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-N-propyldecanamide?
The IUPAC name of 8-oxo-N-propyldecanamide (CID 156819961) is 8-oxo-N-propyldecanamide.
What is the SMILES notation for 8-oxo-N-propyldecanamide?
The canonical SMILES for 8-oxo-N-propyldecanamide is CCCNC(=O)CCCCCCC(=O)CC.
What is the InChIKey of 8-oxo-N-propyldecanamide?
The InChIKey is JCNNMKBXJNVAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-11-14-13(16)10-8-6-5-7-9-12(15)4-2/h3-11H2,1-2H3,(H,14,16).
What are the key properties of 8-oxo-N-propyldecanamide?
8-oxo-N-propyldecanamide has a molecular weight of 227.35 g/mol, XLogP of 2.83, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-N-propyldecanamide is sourced from PubChem (CID 156819961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).