About sodium;hydride;N-propyldodecanamide
sodium;hydride;N-propyldodecanamide (PubChem CID 172999662) has the molecular formula C15H32NNaO
and a molecular weight of 265.42 g/mol. Its IUPAC name is sodium;hydride;N-propyldodecanamide.
Molecular Properties
| Compound Name | sodium;hydride;N-propyldodecanamide |
| PubChem CID | 172999662 |
| Molecular Formula | C15H32NNaO |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | sodium;hydride;N-propyldodecanamide |
| SMILES | CCCCCCCCCCCC(=O)NCCC.[H-].[Na+] |
| InChI | InChI=1S/C15H31NO.Na.H/c1-3-5-6-7-8-9-10-11-12-13-15(17)16-14-4-2;;/h3-14H2,1-2H3,(H,16,17);;/q;+1;-1 |
| InChIKey | SHDBWMRIZFIILG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;N-propyldodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;N-propyldodecanamide?
The IUPAC name of sodium;hydride;N-propyldodecanamide (CID 172999662) is sodium;hydride;N-propyldodecanamide.
What is the SMILES notation for sodium;hydride;N-propyldodecanamide?
The canonical SMILES for sodium;hydride;N-propyldodecanamide is CCCCCCCCCCCC(=O)NCCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;N-propyldodecanamide?
The InChIKey is SHDBWMRIZFIILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO.Na.H/c1-3-5-6-7-8-9-10-11-12-13-15(17)16-14-4-2;;/h3-14H2,1-2H3,(H,16,17);;/q;+1;-1.
What are the key properties of sodium;hydride;N-propyldodecanamide?
sodium;hydride;N-propyldodecanamide has a molecular weight of 265.42 g/mol, XLogP of 1.55, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;N-propyldodecanamide is sourced from PubChem (CID 172999662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).