C13H26N2O4 — CID 89382357
2,4-diethyl-N,N'-bis(2-hydroxyethyl)pentanediamide (PubChem CID 89382357) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,4-diethyl-N,N'-bis(2-hydroxyethyl)pentanediamide.
| Compound Name | 2,4-diethyl-N,N'-bis(2-hydroxyethyl)pentanediamide |
|---|---|
| PubChem CID | 89382357 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2,4-diethyl-N,N'-bis(2-hydroxyethyl)pentanediamide |
| SMILES | CCC(CC(CC)C(=O)NCCO)C(=O)NCCO |
| InChI | InChI=1S/C13H26N2O4/c1-3-10(12(18)14-5-7-16)9-11(4-2)13(19)15-6-8-17/h10-11,16-17H,3-9H2,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | ONYAVXPRYHCAAL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |