C9H18N2O4S2 — CID 23104493
N,N'-bis(2-hydroxyethyl)-2,4-bis(sulfanyl)pentanediamide (PubChem CID 23104493) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N,N'-bis(2-hydroxyethyl)-2,4-bis(sulfanyl)pentanediamide.
| Compound Name | N,N'-bis(2-hydroxyethyl)-2,4-bis(sulfanyl)pentanediamide |
|---|---|
| PubChem CID | 23104493 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N,N'-bis(2-hydroxyethyl)-2,4-bis(sulfanyl)pentanediamide |
| SMILES | O=C(NCCO)C(S)CC(S)C(=O)NCCO |
| InChI | InChI=1S/C9H18N2O4S2/c12-3-1-10-8(14)6(16)5-7(17)9(15)11-2-4-13/h6-7,12-13,16-17H,1-5H2,(H,10,14)(H,11,15) |
| InChIKey | UBIHIEPEYPNEAZ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|