C5H14NO7P — CID 87238089
2-hydroxy-N-(2-hydroxyethyl)propanamide;phosphoric acid (PubChem CID 87238089) has the molecular formula C5H14NO7P and a molecular weight of 231.14 g/mol. Its IUPAC name is 2-hydroxy-N-(2-hydroxyethyl)propanamide;phosphoric acid.
| Compound Name | 2-hydroxy-N-(2-hydroxyethyl)propanamide;phosphoric acid |
|---|---|
| PubChem CID | 87238089 |
| Molecular Formula | C5H14NO7P |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-hydroxy-N-(2-hydroxyethyl)propanamide;phosphoric acid |
| SMILES | CC(O)C(=O)NCCO.O=P(O)(O)O |
| InChI | InChI=1S/C5H11NO3.H3O4P/c1-4(8)5(9)6-2-3-7;1-5(2,3)4/h4,7-8H,2-3H2,1H3,(H,6,9);(H3,1,2,3,4) |
| InChIKey | UHVYOUXOWATKED-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|