C17H34N2O6 — CID 89382356
2,4-diethyl-N,N'-bis[2-(2-hydroxyethoxy)ethyl]pentanediamide (PubChem CID 89382356) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2,4-diethyl-N,N'-bis[2-(2-hydroxyethoxy)ethyl]pentanediamide.
| Compound Name | 2,4-diethyl-N,N'-bis[2-(2-hydroxyethoxy)ethyl]pentanediamide |
|---|---|
| PubChem CID | 89382356 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2,4-diethyl-N,N'-bis[2-(2-hydroxyethoxy)ethyl]pentanediamide |
| SMILES | CCC(CC(CC)C(=O)NCCOCCO)C(=O)NCCOCCO |
| InChI | InChI=1S/C17H34N2O6/c1-3-14(16(22)18-5-9-24-11-7-20)13-15(4-2)17(23)19-6-10-25-12-8-21/h14-15,20-21H,3-13H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | WEBVZGJAGOFVPC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|