C8H18N2O3 — CID 61273537
2-amino-N-[2-(2-hydroxyethoxy)ethyl]butanamide (PubChem CID 61273537) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-amino-N-[2-(2-hydroxyethoxy)ethyl]butanamide.
| Compound Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 61273537 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]butanamide |
| SMILES | CCC(N)C(=O)NCCOCCO |
| InChI | InChI=1S/C8H18N2O3/c1-2-7(9)8(12)10-3-5-13-6-4-11/h7,11H,2-6,9H2,1H3,(H,10,12) |
| InChIKey | YEVFKSLQYBMPCT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|