C11H25N3O4 — CID 122551407
2-amino-N-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethyl]butanamide (PubChem CID 122551407) has the molecular formula C11H25N3O4 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-amino-N-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 2-amino-N-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 122551407 |
| Molecular Formula | C11H25N3O4 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 2-amino-N-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CCC(N)C(=O)NCCOCCOCCNCO |
| InChI | InChI=1S/C11H25N3O4/c1-2-10(12)11(16)14-4-6-18-8-7-17-5-3-13-9-15/h10,13,15H,2-9,12H2,1H3,(H,14,16) |
| InChIKey | DBJUOIXYIZCNDY-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|