C8H18N2O5S — CID 66168706
2-amino-N-(2,3-dihydroxypropyl)-4-methylsulfonylbutanamide (PubChem CID 66168706) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydroxypropyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(2,3-dihydroxypropyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 66168706 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-amino-N-(2,3-dihydroxypropyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)NCC(O)CO |
| InChI | InChI=1S/C8H18N2O5S/c1-16(14,15)3-2-7(9)8(13)10-4-6(12)5-11/h6-7,11-12H,2-5,9H2,1H3,(H,10,13) |
| InChIKey | AQHZRMLUGFWWOK-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |