C13H29N3O3S — CID 43098583
2-amino-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylsulfonylbutanamide (PubChem CID 43098583) has the molecular formula C13H29N3O3S and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-amino-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43098583 |
| Molecular Formula | C13H29N3O3S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-amino-N-[2-[di(propan-2-yl)amino]ethyl]-4-methylsulfonylbutanamide |
| SMILES | CC(C)N(CCNC(=O)C(N)CCS(C)(=O)=O)C(C)C |
| InChI | InChI=1S/C13H29N3O3S/c1-10(2)16(11(3)4)8-7-15-13(17)12(14)6-9-20(5,18)19/h10-12H,6-9,14H2,1-5H3,(H,15,17) |
| InChIKey | GEAYJWFGFVPSGQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |