C10H23N3O3S — CID 54913489
2-amino-N-[2-(dimethylamino)propyl]-4-methylsulfonylbutanamide (PubChem CID 54913489) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)propyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)propyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 54913489 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)propyl]-4-methylsulfonylbutanamide |
| SMILES | CC(CNC(=O)C(N)CCS(C)(=O)=O)N(C)C |
| InChI | InChI=1S/C10H23N3O3S/c1-8(13(2)3)7-12-10(14)9(11)5-6-17(4,15)16/h8-9H,5-7,11H2,1-4H3,(H,12,14) |
| InChIKey | HAPYGJZSPMPPDL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |