C8H16N2O5S — CID 60914301
methyl 2-[(2-amino-4-methylsulfonylbutanoyl)amino]acetate (PubChem CID 60914301) has the molecular formula C8H16N2O5S and a molecular weight of 252.29 g/mol. Its IUPAC name is methyl 2-[(2-amino-4-methylsulfonylbutanoyl)amino]acetate.
| Compound Name | methyl 2-[(2-amino-4-methylsulfonylbutanoyl)amino]acetate |
|---|---|
| PubChem CID | 60914301 |
| Molecular Formula | C8H16N2O5S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | methyl 2-[(2-amino-4-methylsulfonylbutanoyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C8H16N2O5S/c1-15-7(11)5-10-8(12)6(9)3-4-16(2,13)14/h6H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | ABYVJBUILYYLAA-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |