C13H29ClN2O3S — CID 119957267
2-amino-N-(5,5-dimethylhexyl)-4-methylsulfonylbutanamide;hydrochloride (PubChem CID 119957267) has the molecular formula C13H29ClN2O3S and a molecular weight of 328.91 g/mol. Its IUPAC name is 2-amino-N-(5,5-dimethylhexyl)-4-methylsulfonylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-(5,5-dimethylhexyl)-4-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119957267 |
| Molecular Formula | C13H29ClN2O3S |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-amino-N-(5,5-dimethylhexyl)-4-methylsulfonylbutanamide;hydrochloride |
| SMILES | CC(C)(C)CCCCNC(=O)C(N)CCS(C)(=O)=O.Cl |
| InChI | InChI=1S/C13H28N2O3S.ClH/c1-13(2,3)8-5-6-9-15-12(16)11(14)7-10-19(4,17)18;/h11H,5-10,14H2,1-4H3,(H,15,16);1H |
| InChIKey | OZOMNZCZOLVJRU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|