C11H24N2O3S — CID 115751030
2-amino-N-(2-methylpentan-2-yl)-4-methylsulfonylbutanamide (PubChem CID 115751030) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-amino-N-(2-methylpentan-2-yl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(2-methylpentan-2-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 115751030 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-amino-N-(2-methylpentan-2-yl)-4-methylsulfonylbutanamide |
| SMILES | CCCC(C)(C)NC(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O3S/c1-5-7-11(2,3)13-10(14)9(12)6-8-17(4,15)16/h9H,5-8,12H2,1-4H3,(H,13,14) |
| InChIKey | YEPIDRJAGFKGIM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |