C9H20N2O4S2 — CID 115751066
2-amino-N-(3-methylsulfinylpropyl)-4-methylsulfonylbutanamide (PubChem CID 115751066) has the molecular formula C9H20N2O4S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-amino-N-(3-methylsulfinylpropyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(3-methylsulfinylpropyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 115751066 |
| Molecular Formula | C9H20N2O4S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-amino-N-(3-methylsulfinylpropyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)CCCNC(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H20N2O4S2/c1-16(13)6-3-5-11-9(12)8(10)4-7-17(2,14)15/h8H,3-7,10H2,1-2H3,(H,11,12) |
| InChIKey | CFOTVUWUOPJXOL-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|