C8H17N3O4S — CID 43545601
2-amino-N-(1-amino-1-oxopropan-2-yl)-4-methylsulfonylbutanamide (PubChem CID 43545601) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-amino-N-(1-amino-1-oxopropan-2-yl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(1-amino-1-oxopropan-2-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43545601 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-amino-N-(1-amino-1-oxopropan-2-yl)-4-methylsulfonylbutanamide |
| SMILES | CC(NC(=O)C(N)CCS(C)(=O)=O)C(N)=O |
| InChI | InChI=1S/C8H17N3O4S/c1-5(7(10)12)11-8(13)6(9)3-4-16(2,14)15/h5-6H,3-4,9H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | RKHPHSOFSJJCQS-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |