C7H15N3O5 — CID 21447998
3-amino-4-[(1-amino-1-oxopropan-2-yl)amino]-4-oxobutanoic acid;hydrate (PubChem CID 21447998) has the molecular formula C7H15N3O5 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-amino-4-[(1-amino-1-oxopropan-2-yl)amino]-4-oxobutanoic acid;hydrate.
| Compound Name | 3-amino-4-[(1-amino-1-oxopropan-2-yl)amino]-4-oxobutanoic acid;hydrate |
|---|---|
| PubChem CID | 21447998 |
| Molecular Formula | C7H15N3O5 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-amino-4-[(1-amino-1-oxopropan-2-yl)amino]-4-oxobutanoic acid;hydrate |
| SMILES | CC(NC(=O)C(N)CC(=O)O)C(N)=O.O |
| InChI | InChI=1S/C7H13N3O4.H2O/c1-3(6(9)13)10-7(14)4(8)2-5(11)12;/h3-4H,2,8H2,1H3,(H2,9,13)(H,10,14)(H,11,12);1H2 |
| InChIKey | JZZOEJNDYNQACX-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 167.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |