C8H14N2O5 — CID 64895300
3-amino-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 64895300) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is 3-amino-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64895300 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-amino-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](C)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-4(8(14)15-2)10-7(13)5(9)3-6(11)12/h4-5H,3,9H2,1-2H3,(H,10,13)(H,11,12)/t4-,5?/m0/s1 |
| InChIKey | YWFYACAKCGZHAA-ROLXFIACSA-N |
| XLogP | -1.53 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |