C16H28N2O5 — CID 54415040
(3S)-3-amino-4-[(1-methoxy-6-methyl-1-oxo-5-propan-2-ylhept-3-en-2-yl)amino]-4-oxobutanoic acid (PubChem CID 54415040) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3S)-3-amino-4-[(1-methoxy-6-methyl-1-oxo-5-propan-2-ylhept-3-en-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[(1-methoxy-6-methyl-1-oxo-5-propan-2-ylhept-3-en-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54415040 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (3S)-3-amino-4-[(1-methoxy-6-methyl-1-oxo-5-propan-2-ylhept-3-en-2-yl)amino]-4-oxobutanoic acid |
| SMILES | COC(=O)C(C=CC(C(C)C)C(C)C)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C16H28N2O5/c1-9(2)11(10(3)4)6-7-13(16(22)23-5)18-15(21)12(17)8-14(19)20/h6-7,9-13H,8,17H2,1-5H3,(H,18,21)(H,19,20)/t12-,13?/m0/s1 |
| InChIKey | VWURYIVBFZZKHW-UEWDXFNNSA-N |
| XLogP | 0.93 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|