C11H21N3O3 — CID 163623067
methyl (Z)-2-[[(2S)-2,3-diaminopropanoyl]amino]-5-methylhex-3-enoate (PubChem CID 163623067) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is methyl (Z)-2-[[(2S)-2,3-diaminopropanoyl]amino]-5-methylhex-3-enoate.
| Compound Name | methyl (Z)-2-[[(2S)-2,3-diaminopropanoyl]amino]-5-methylhex-3-enoate |
|---|---|
| PubChem CID | 163623067 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | methyl (Z)-2-[[(2S)-2,3-diaminopropanoyl]amino]-5-methylhex-3-enoate |
| SMILES | COC(=O)C(/C=C\C(C)C)NC(=O)[C@@H](N)CN |
| InChI | InChI=1S/C11H21N3O3/c1-7(2)4-5-9(11(16)17-3)14-10(15)8(13)6-12/h4-5,7-9H,6,12-13H2,1-3H3,(H,14,15)/b5-4-/t8-,9?/m0/s1 |
| InChIKey | HPUVSKAJIKTRDK-JNEXSOJQSA-N |
| XLogP | -0.86 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|