C6H15N3O — CID 166956225
2,3-diamino-N-propan-2-ylpropanamide (PubChem CID 166956225) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 2,3-diamino-N-propan-2-ylpropanamide.
| Compound Name | 2,3-diamino-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 166956225 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 2,3-diamino-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(N)CN |
| InChI | InChI=1S/C6H15N3O/c1-4(2)9-6(10)5(8)3-7/h4-5H,3,7-8H2,1-2H3,(H,9,10) |
| InChIKey | SPACSZHGQWBVGK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |