C6H16N4O — CID 131850934
(2S)-2-amino-N-(1,3-diaminopropan-2-yl)propanamide (PubChem CID 131850934) has the molecular formula C6H16N4O and a molecular weight of 160.22 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-diaminopropan-2-yl)propanamide.
| Compound Name | (2S)-2-amino-N-(1,3-diaminopropan-2-yl)propanamide |
|---|---|
| PubChem CID | 131850934 |
| Molecular Formula | C6H16N4O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (2S)-2-amino-N-(1,3-diaminopropan-2-yl)propanamide |
| SMILES | C[C@H](N)C(=O)NC(CN)CN |
| InChI | InChI=1S/C6H16N4O/c1-4(9)6(11)10-5(2-7)3-8/h4-5H,2-3,7-9H2,1H3,(H,10,11)/t4-/m0/s1 |
| InChIKey | FSWCOBYMSSHQCS-BYPYZUCNSA-N |
| XLogP | -2.26 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |