C8H16N2O3 — CID 62669479
methyl 2-[(3-amino-2-methylpropanoyl)amino]propanoate (PubChem CID 62669479) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is methyl 2-[(3-amino-2-methylpropanoyl)amino]propanoate.
| Compound Name | methyl 2-[(3-amino-2-methylpropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 62669479 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | methyl 2-[(3-amino-2-methylpropanoyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C(C)CN |
| InChI | InChI=1S/C8H16N2O3/c1-5(4-9)7(11)10-6(2)8(12)13-3/h5-6H,4,9H2,1-3H3,(H,10,11) |
| InChIKey | CUGFUWOTLDARQV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |