C7H14N2O4 — CID 155460298
methyl (2R)-2-[[(2R)-2-amino-3-hydroxypropanoyl]amino]propanoate (PubChem CID 155460298) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-2-amino-3-hydroxypropanoyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2R)-2-amino-3-hydroxypropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 155460298 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | methyl (2R)-2-[[(2R)-2-amino-3-hydroxypropanoyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)[C@H](N)CO |
| InChI | InChI=1S/C7H14N2O4/c1-4(7(12)13-2)9-6(11)5(8)3-10/h4-5,10H,3,8H2,1-2H3,(H,9,11)/t4-,5-/m1/s1 |
| InChIKey | VGRRCGOKYUBRQO-RFZPGFLSSA-N |
| XLogP | -2.02 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |