C11H21N3O5 — CID 18223804
2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-3-methylbutanoic acid (PubChem CID 18223804) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18223804 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-3-methylbutanoic acid |
| SMILES | CC(NC(=O)C(N)CO)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H21N3O5/c1-5(2)8(11(18)19)14-9(16)6(3)13-10(17)7(12)4-15/h5-8,15H,4,12H2,1-3H3,(H,13,17)(H,14,16)(H,18,19) |
| InChIKey | HBZBPFLJNDXRAY-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |