C14H27N3O5 — CID 18224161
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18224161) has the molecular formula C14H27N3O5 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18224161 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(N)CO)C(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N3O5/c1-5-8(4)11(14(21)22)17-13(20)10(7(2)3)16-12(19)9(15)6-18/h7-11,18H,5-6,15H2,1-4H3,(H,16,19)(H,17,20)(H,21,22) |
| InChIKey | MFQMZDPAZRZAPV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |