C28H48N6O13 — CID 19967764
2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 19967764) has the molecular formula C28H48N6O13 and a molecular weight of 676.72 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19967764 |
| Molecular Formula | C28H48N6O13 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(NC(=O)C(NC(=O)C(N)CO)C(C)C)C(C)O)C(=O)O |
| InChI | InChI=1S/C28H48N6O13/c1-6-13(4)21(28(46)47)33-25(43)17(8-10-19(39)40)30-24(42)16(7-9-18(37)38)31-27(45)22(14(5)36)34-26(44)20(12(2)3)32-23(41)15(29)11-35/h12-17,20-22,35-36H,6-11,29H2,1-5H3,(H,30,42)(H,31,45)(H,32,41)(H,33,43)(H,34,44)(H,37,38)(H,39,40)(H,46,47) |
| InChIKey | LNMLSCQGYIPFRP-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 323.88 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |