C13H25N3O5 — CID 18224171
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid (PubChem CID 18224171) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18224171 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(NC(=O)C(N)CO)C(C)C)C(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-6(2)9(15-11(18)8(14)5-17)12(19)16-10(7(3)4)13(20)21/h6-10,17H,5,14H2,1-4H3,(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | HSWXBJCBYSWBPT-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |