C11H21N3O7 — CID 18224109
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18224109) has the molecular formula C11H21N3O7 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18224109 |
| Molecular Formula | C11H21N3O7 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(NC(=O)C(N)CO)C(C)O)C(=O)O |
| InChI | InChI=1S/C11H21N3O7/c1-4(16)7(13-9(18)6(12)3-15)10(19)14-8(5(2)17)11(20)21/h4-8,15-17H,3,12H2,1-2H3,(H,13,18)(H,14,19)(H,20,21) |
| InChIKey | VLMIUSLQONKLDV-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |