C11H20N2O5 — CID 75018302
4-[(1-acetyloxy-3-methylbutan-2-yl)amino]-3-amino-4-oxobutanoic acid (PubChem CID 75018302) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[(1-acetyloxy-3-methylbutan-2-yl)amino]-3-amino-4-oxobutanoic acid.
| Compound Name | 4-[(1-acetyloxy-3-methylbutan-2-yl)amino]-3-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 75018302 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-[(1-acetyloxy-3-methylbutan-2-yl)amino]-3-amino-4-oxobutanoic acid |
| SMILES | CC(=O)OCC(NC(=O)C(N)CC(=O)O)C(C)C |
| InChI | InChI=1S/C11H20N2O5/c1-6(2)9(5-18-7(3)14)13-11(17)8(12)4-10(15)16/h6,8-9H,4-5,12H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | DQRJPYOIJCVCRB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |