C11H21N3O — CID 65266802
3-amino-N-(2-cyanopropyl)-2,2,3-trimethylbutanamide (PubChem CID 65266802) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-amino-N-(2-cyanopropyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2-cyanopropyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65266802 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-amino-N-(2-cyanopropyl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C#N)CNC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C11H21N3O/c1-8(6-12)7-14-9(15)10(2,3)11(4,5)13/h8H,7,13H2,1-5H3,(H,14,15) |
| InChIKey | LDLWPPBEGLJRBG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |